About ethane;4-(methoxymethyl)-1,3-dioxol-2-one
ethane;4-(methoxymethyl)-1,3-dioxol-2-one (PubChem CID 143334465) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is ethane;4-(methoxymethyl)-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | ethane;4-(methoxymethyl)-1,3-dioxol-2-one |
| PubChem CID | 143334465 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | ethane;4-(methoxymethyl)-1,3-dioxol-2-one |
| SMILES | CC.COCc1coc(=O)o1 |
| InChI | InChI=1S/C5H6O4.C2H6/c1-7-2-4-3-8-5(6)9-4;1-2/h3H,2H2,1H3;1-2H3 |
| InChIKey | FWVIZXGUGHRFJY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-(methoxymethyl)-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(methoxymethyl)-1,3-dioxol-2-one?
The IUPAC name of ethane;4-(methoxymethyl)-1,3-dioxol-2-one (CID 143334465) is ethane;4-(methoxymethyl)-1,3-dioxol-2-one.
What is the SMILES notation for ethane;4-(methoxymethyl)-1,3-dioxol-2-one?
The canonical SMILES for ethane;4-(methoxymethyl)-1,3-dioxol-2-one is CC.COCc1coc(=O)o1.
What is the InChIKey of ethane;4-(methoxymethyl)-1,3-dioxol-2-one?
The InChIKey is FWVIZXGUGHRFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C2H6/c1-7-2-4-3-8-5(6)9-4;1-2/h3H,2H2,1H3;1-2H3.
What are the key properties of ethane;4-(methoxymethyl)-1,3-dioxol-2-one?
ethane;4-(methoxymethyl)-1,3-dioxol-2-one has a molecular weight of 160.17 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(methoxymethyl)-1,3-dioxol-2-one is sourced from PubChem (CID 143334465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).