C31H36F3NO5 — CID 143334612
(3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol (PubChem CID 143334612) has the molecular formula C31H36F3NO5 and a molecular weight of 559.63 g/mol. Its IUPAC name is (3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol.
| Compound Name | (3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol |
|---|---|
| PubChem CID | 143334612 |
| Molecular Formula | C31H36F3NO5 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | (3S,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol |
| SMILES | O[C@H]1CN(CCOCC(F)(F)F)[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H36F3NO5/c32-31(33,34)23-37-17-16-35-18-28(36)30(40-21-26-14-8-3-9-15-26)29(39-20-25-12-6-2-7-13-25)27(35)22-38-19-24-10-4-1-5-11-24/h1-15,27-30,36H,16-23H2/t27-,28+,29-,30-/m1/s1 |
| InChIKey | WQOCHYBVLMKYTE-GOGZTAQTSA-N |
| XLogP | 5.00 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|