C15H25BN2O4 — CID 143334744
N-[2-[butyl(methyl)amino]-2-oxoethyl]benzamide;methylboronic acid (PubChem CID 143334744) has the molecular formula C15H25BN2O4 and a molecular weight of 308.19 g/mol. Its IUPAC name is N-[2-[butyl(methyl)amino]-2-oxoethyl]benzamide;methylboronic acid.
| Compound Name | N-[2-[butyl(methyl)amino]-2-oxoethyl]benzamide;methylboronic acid |
|---|---|
| PubChem CID | 143334744 |
| Molecular Formula | C15H25BN2O4 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[2-[butyl(methyl)amino]-2-oxoethyl]benzamide;methylboronic acid |
| SMILES | CB(O)O.CCCCN(C)C(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O2.CH5BO2/c1-3-4-10-16(2)13(17)11-15-14(18)12-8-6-5-7-9-12;1-2(3)4/h5-9H,3-4,10-11H2,1-2H3,(H,15,18);3-4H,1H3 |
| InChIKey | HIECCNQLQKAXEE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|