C13H11F3O3 — CID 143335154
(3,4,5-trifluorophenyl) 5-methyl-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 143335154) has the molecular formula C13H11F3O3 and a molecular weight of 272.22 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 5-methyl-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | (3,4,5-trifluorophenyl) 5-methyl-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 143335154 |
| Molecular Formula | C13H11F3O3 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (3,4,5-trifluorophenyl) 5-methyl-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CC1=CCC(C(=O)Oc2cc(F)c(F)c(F)c2)OC1 |
| InChI | InChI=1S/C13H11F3O3/c1-7-2-3-11(18-6-7)13(17)19-8-4-9(14)12(16)10(15)5-8/h2,4-5,11H,3,6H2,1H3 |
| InChIKey | VCFNMBGXMFVEAQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|