About ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane
ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane (PubChem CID 143335298) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane.
Molecular Properties
| Compound Name | ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane |
| PubChem CID | 143335298 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane |
| SMILES | CC.CC1=CCNC(=S)C1.CCC |
| InChI | InChI=1S/C6H9NS.C3H8.C2H6/c1-5-2-3-7-6(8)4-5;1-3-2;1-2/h2H,3-4H2,1H3,(H,7,8);3H2,1-2H3;1-2H3 |
| InChIKey | IXJIWWFRAZHEGT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane?
The IUPAC name of ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane (CID 143335298) is ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane.
What is the SMILES notation for ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane?
The canonical SMILES for ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane is CC.CC1=CCNC(=S)C1.CCC.
What is the InChIKey of ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane?
The InChIKey is IXJIWWFRAZHEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS.C3H8.C2H6/c1-5-2-3-7-6(8)4-5;1-3-2;1-2/h2H,3-4H2,1H3,(H,7,8);3H2,1-2H3;1-2H3.
What are the key properties of ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane?
ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane has a molecular weight of 201.38 g/mol, XLogP of 3.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-2,5-dihydro-1H-pyridine-6-thione;propane is sourced from PubChem (CID 143335298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).