C13H19NO — CID 143335320
N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)formamide (PubChem CID 143335320) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)formamide.
| Compound Name | N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)formamide |
|---|---|
| PubChem CID | 143335320 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | N-(3,3-dimethyl-7-propylcyclohepta-1,4,6-trien-1-yl)formamide |
| SMILES | CCCC1=CC=CC(C)(C)C=C1NC=O |
| InChI | InChI=1S/C13H19NO/c1-4-6-11-7-5-8-13(2,3)9-12(11)14-10-15/h5,7-10H,4,6H2,1-3H3,(H,14,15) |
| InChIKey | DUAZVWSIIQBNNY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|