C18H8O5 — CID 143335534
4-hydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione (PubChem CID 143335534) has the molecular formula C18H8O5 and a molecular weight of 304.26 g/mol. Its IUPAC name is 4-hydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione.
| Compound Name | 4-hydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione |
|---|---|
| PubChem CID | 143335534 |
| Molecular Formula | C18H8O5 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-hydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-13,15-dione |
| SMILES | O=c1oc(=O)c2ccc3c4cc(O)ccc4oc4ccc1c2c43 |
| InChI | InChI=1S/C18H8O5/c19-8-1-5-13-12(7-8)9-2-3-10-15-11(18(21)23-17(10)20)4-6-14(22-13)16(9)15/h1-7,19H |
| InChIKey | LTEPNKOIFKAAIM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|