C23H20Cl2N2O5 — CID 143335631
2-[5'-chloro-5-[2-(4-chloro-3-pyridinyl)ethyl]-2,2',6-trioxospiro[cycloheptane-1,3'-indole]-1'-yl]acetic acid (PubChem CID 143335631) has the molecular formula C23H20Cl2N2O5 and a molecular weight of 475.33 g/mol. Its IUPAC name is 2-[5'-chloro-5-[2-(4-chloro-3-pyridinyl)ethyl]-2,2',6-trioxospiro[cycloheptane-1,3'-indole]-1'-yl]acetic acid.
| Compound Name | 2-[5'-chloro-5-[2-(4-chloro-3-pyridinyl)ethyl]-2,2',6-trioxospiro[cycloheptane-1,3'-indole]-1'-yl]acetic acid |
|---|---|
| PubChem CID | 143335631 |
| Molecular Formula | C23H20Cl2N2O5 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 2-[5'-chloro-5-[2-(4-chloro-3-pyridinyl)ethyl]-2,2',6-trioxospiro[cycloheptane-1,3'-indole]-1'-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2(CC(=O)C(CCc3cnccc3Cl)CCC2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H20Cl2N2O5/c24-15-4-5-18-16(9-15)23(22(32)27(18)12-21(30)31)10-19(28)13(3-6-20(23)29)1-2-14-11-26-8-7-17(14)25/h4-5,7-9,11,13H,1-3,6,10,12H2,(H,30,31) |
| InChIKey | NIJHZPCQTBINDJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|