C13H17N3O3S3 — CID 143335714
N-[5-[5-(2,3-dihydroxypropylamino)sulfanylthiophen-2-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 143335714) has the molecular formula C13H17N3O3S3 and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[5-[5-(2,3-dihydroxypropylamino)sulfanylthiophen-2-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[5-(2,3-dihydroxypropylamino)sulfanylthiophen-2-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 143335714 |
| Molecular Formula | C13H17N3O3S3 |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-[5-[5-(2,3-dihydroxypropylamino)sulfanylthiophen-2-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2ccc(SNCC(O)CO)s2)s1 |
| InChI | InChI=1S/C13H17N3O3S3/c1-7-12(21-13(15-7)16-8(2)18)10-3-4-11(20-10)22-14-5-9(19)6-17/h3-4,9,14,17,19H,5-6H2,1-2H3,(H,15,16,18) |
| InChIKey | VGHNIJLBTSIFED-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|