C21H27N3O4S — CID 143336017
(5E)-5-hydroxy-4-methylideneocta-5,7-dienal;6-(2-methoxyacetyl)-2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 143336017) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is (5E)-5-hydroxy-4-methylideneocta-5,7-dienal;6-(2-methoxyacetyl)-2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | (5E)-5-hydroxy-4-methylideneocta-5,7-dienal;6-(2-methoxyacetyl)-2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 143336017 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (5E)-5-hydroxy-4-methylideneocta-5,7-dienal;6-(2-methoxyacetyl)-2-(methylamino)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | C=C/C=C(/O)C(=C)CCC=O.CNc1sc2c(c1C#N)CCN(C(=O)COC)C2 |
| InChI | InChI=1S/C12H15N3O2S.C9H12O2/c1-14-12-9(5-13)8-3-4-15(6-10(8)18-12)11(16)7-17-2;1-3-5-9(11)8(2)6-4-7-10/h14H,3-4,6-7H2,1-2H3;3,5,7,11H,1-2,4,6H2/b;9-5+ |
| InChIKey | OFJRPCJWJPMFAP-DTDKZNDQSA-N |
| XLogP | 3.34 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|