C17H26F3NO2S — CID 143336299
N-[2-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]ethyl]-2,3,4-trifluoro-N-methylbenzamide (PubChem CID 143336299) has the molecular formula C17H26F3NO2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[2-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]ethyl]-2,3,4-trifluoro-N-methylbenzamide.
| Compound Name | N-[2-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]ethyl]-2,3,4-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 143336299 |
| Molecular Formula | C17H26F3NO2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[2-[[tert-butyl(dimethyl)-λ4-sulfanyl]methoxy]ethyl]-2,3,4-trifluoro-N-methylbenzamide |
| SMILES | CN(CCOCS(C)(C)C(C)(C)C)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H26F3NO2S/c1-17(2,3)24(5,6)11-23-10-9-21(4)16(22)12-7-8-13(18)15(20)14(12)19/h7-8H,9-11H2,1-6H3 |
| InChIKey | BNCWAVCFCKPDGN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|