About 5-ethyl-4a,5,6,7-tetrahydrocinnoline
5-ethyl-4a,5,6,7-tetrahydrocinnoline (PubChem CID 143336379) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 5-ethyl-4a,5,6,7-tetrahydrocinnoline.
Molecular Properties
| Compound Name | 5-ethyl-4a,5,6,7-tetrahydrocinnoline |
| PubChem CID | 143336379 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 5-ethyl-4a,5,6,7-tetrahydrocinnoline |
| SMILES | CCC1CCC=C2N=NC=CC21 |
| InChI | InChI=1S/C10H14N2/c1-2-8-4-3-5-10-9(8)6-7-11-12-10/h5-9H,2-4H2,1H3 |
| InChIKey | ZQQLLISLPCCVBQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-4a,5,6,7-tetrahydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4a,5,6,7-tetrahydrocinnoline?
The IUPAC name of 5-ethyl-4a,5,6,7-tetrahydrocinnoline (CID 143336379) is 5-ethyl-4a,5,6,7-tetrahydrocinnoline.
What is the SMILES notation for 5-ethyl-4a,5,6,7-tetrahydrocinnoline?
The canonical SMILES for 5-ethyl-4a,5,6,7-tetrahydrocinnoline is CCC1CCC=C2N=NC=CC21.
What is the InChIKey of 5-ethyl-4a,5,6,7-tetrahydrocinnoline?
The InChIKey is ZQQLLISLPCCVBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-8-4-3-5-10-9(8)6-7-11-12-10/h5-9H,2-4H2,1H3.
What are the key properties of 5-ethyl-4a,5,6,7-tetrahydrocinnoline?
5-ethyl-4a,5,6,7-tetrahydrocinnoline has a molecular weight of 162.24 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4a,5,6,7-tetrahydrocinnoline is sourced from PubChem (CID 143336379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).