C9H18N2 — CID 143336614
ethane;1,3,6-trimethyl-2H-pyrazine (PubChem CID 143336614) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;1,3,6-trimethyl-2H-pyrazine.
| Compound Name | ethane;1,3,6-trimethyl-2H-pyrazine |
|---|---|
| PubChem CID | 143336614 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;1,3,6-trimethyl-2H-pyrazine |
| SMILES | CC.CC1=CN=C(C)CN1C |
| InChI | InChI=1S/C7H12N2.C2H6/c1-6-5-9(3)7(2)4-8-6;1-2/h4H,5H2,1-3H3;1-2H3 |
| InChIKey | MHVOIXKNMPFWMR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |