C41H71N3 — CID 143336771
ethane;N-[(4-ethylpiperidin-1-yl)methyl]-N-methyl-3-methylidene-4-[(1E,7Z)-2,6,9-trimethyl-4-[(1Z,3E)-penta-1,3-dienyl]cyclodeca-1,7-dien-1-yl]iminopentan-1-amine;hexa-1,5-diene (PubChem CID 143336771) has the molecular formula C41H71N3 and a molecular weight of 606.04 g/mol. Its IUPAC name is ethane;N-[(4-ethylpiperidin-1-yl)methyl]-N-methyl-3-methylidene-4-[(1E,7Z)-2,6,9-trimethyl-4-[(1Z,3E)-penta-1,3-dienyl]cyclodeca-1,7-dien-1-yl]iminopentan-1-amine;hexa-1,5-diene.
| Compound Name | ethane;N-[(4-ethylpiperidin-1-yl)methyl]-N-methyl-3-methylidene-4-[(1E,7Z)-2,6,9-trimethyl-4-[(1Z,3E)-penta-1,3-dienyl]cyclodeca-1,7-dien-1-yl]iminopentan-1-amine;hexa-1,5-diene |
|---|---|
| PubChem CID | 143336771 |
| Molecular Formula | C41H71N3 |
| Molecular Weight | 606.04 g/mol |
| Exact Mass | 605.56 |
| IUPAC Name | ethane;N-[(4-ethylpiperidin-1-yl)methyl]-N-methyl-3-methylidene-4-[(1E,7Z)-2,6,9-trimethyl-4-[(1Z,3E)-penta-1,3-dienyl]cyclodeca-1,7-dien-1-yl]iminopentan-1-amine;hexa-1,5-diene |
| SMILES | C=C(CCN(C)CN1CCC(CC)CC1)/C(C)=N/C1=C(\C)CC(/C=C\C=C\C)CC(C)/C=C\C(C)C1.C=CCCC=C.CC |
| InChI | InChI=1S/C33H55N3.C6H10.C2H6/c1-9-11-12-13-32-22-26(3)14-15-27(4)23-33(29(6)24-32)34-30(7)28(5)16-19-35(8)25-36-20-17-31(10-2)18-21-36;1-3-5-6-4-2;1-2/h9,11-15,26-27,31-32H,5,10,16-25H2,1-4,6-8H3;3-4H,1-2,5-6H2;1-2H3/b11-9+,13-12-,15-14-,33-29+,34-30+;; |
| InChIKey | GOPZNRAEZJGFBF-OMHBOUAISA-N |
| XLogP | 11.60 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.04 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|