About 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide
1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide (PubChem CID 143336815) has the molecular formula C12H10N4O2S2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide.
Molecular Properties
| Compound Name | 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide |
| PubChem CID | 143336815 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide |
| SMILES | CSON=C(C#N)c1ccc(C(C#N)=NOSC)cc1 |
| InChI | InChI=1S/C12H10N4O2S2/c1-19-17-15-11(7-13)9-3-5-10(6-4-9)12(8-14)16-18-20-2/h3-6H,1-2H3 |
| InChIKey | FLQQJYZCHZHOSE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide?
The IUPAC name of 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide (CID 143336815) is 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide.
What is the SMILES notation for 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide?
The canonical SMILES for 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide is CSON=C(C#N)c1ccc(C(C#N)=NOSC)cc1.
What is the InChIKey of 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide?
The InChIKey is FLQQJYZCHZHOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2S2/c1-19-17-15-11(7-13)9-3-5-10(6-4-9)12(8-14)16-18-20-2/h3-6H,1-2H3.
What are the key properties of 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide?
1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide has a molecular weight of 306.37 g/mol, XLogP of 2.73, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-bis(methylsulfanyloxy)benzene-1,4-dicarboximidoyl cyanide is sourced from PubChem (CID 143336815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).