C18H32 — CID 143337118
ethane;(3Z,5Z,8E)-8-ethyl-4-methylundeca-3,5,8-trien-1-yne (PubChem CID 143337118) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is ethane;(3Z,5Z,8E)-8-ethyl-4-methylundeca-3,5,8-trien-1-yne.
| Compound Name | ethane;(3Z,5Z,8E)-8-ethyl-4-methylundeca-3,5,8-trien-1-yne |
|---|---|
| PubChem CID | 143337118 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | ethane;(3Z,5Z,8E)-8-ethyl-4-methylundeca-3,5,8-trien-1-yne |
| SMILES | C#C/C=C(C)\C=C/C/C(=C/CC)CC.CC.CC |
| InChI | InChI=1S/C14H20.2C2H6/c1-5-9-13(4)11-8-12-14(7-3)10-6-2;2*1-2/h1,8-11H,6-7,12H2,2-4H3;2*1-2H3/b11-8-,13-9-,14-10+;; |
| InChIKey | BJZBMUYCNMXYSU-BYRDDZKRSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|