About ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane
ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane (PubChem CID 143337132) has the molecular formula C11H21F3O
and a molecular weight of 226.28 g/mol. Its IUPAC name is ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane.
Molecular Properties
| Compound Name | ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane |
| PubChem CID | 143337132 |
| Molecular Formula | C11H21F3O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane |
| SMILES | C/C=C\C(C)=C/C.CC.COC(F)(F)F |
| InChI | InChI=1S/C7H12.C2H3F3O.C2H6/c1-4-6-7(3)5-2;1-6-2(3,4)5;1-2/h4-6H,1-3H3;1H3;1-2H3/b6-4-,7-5-;; |
| InChIKey | JPFSYXDAUQQFLT-RVMHNBBFSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane?
The IUPAC name of ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane (CID 143337132) is ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane.
What is the SMILES notation for ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane?
The canonical SMILES for ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane is C/C=C\C(C)=C/C.CC.COC(F)(F)F.
What is the InChIKey of ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane?
The InChIKey is JPFSYXDAUQQFLT-RVMHNBBFSA-N. The full InChI is InChI=1S/C7H12.C2H3F3O.C2H6/c1-4-6-7(3)5-2;1-6-2(3,4)5;1-2/h4-6H,1-3H3;1H3;1-2H3/b6-4-,7-5-;;.
What are the key properties of ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane?
ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane has a molecular weight of 226.28 g/mol, XLogP of 4.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2Z,4Z)-3-methylhexa-2,4-diene;trifluoro(methoxy)methane is sourced from PubChem (CID 143337132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).