C33H45N3O3 — CID 143337306
(3Z,5E)-2-imino-6-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;pentane;prop-1-ene (PubChem CID 143337306) has the molecular formula C33H45N3O3 and a molecular weight of 531.74 g/mol. Its IUPAC name is (3Z,5E)-2-imino-6-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;pentane;prop-1-ene.
| Compound Name | (3Z,5E)-2-imino-6-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;pentane;prop-1-ene |
|---|---|
| PubChem CID | 143337306 |
| Molecular Formula | C33H45N3O3 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | (3Z,5E)-2-imino-6-[1-(2-methylpropyl)-2,3-dihydroindol-5-yl]-3-(phenylcarbamoyl)hexa-3,5-dienoic acid;pentane;prop-1-ene |
| SMILES | C=CC.CCCCC.[H]/N=C(C(=O)O)/C(=C/C=C/c1ccc2c(c1)CCN2CC(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H27N3O3.C5H12.C3H6/c1-17(2)16-28-14-13-19-15-18(11-12-22(19)28)7-6-10-21(23(26)25(30)31)24(29)27-20-8-4-3-5-9-20;1-3-5-4-2;1-3-2/h3-12,15,17,26H,13-14,16H2,1-2H3,(H,27,29)(H,30,31);3-5H2,1-2H3;3H,1H2,2H3/b7-6+,21-10-,26-23-;; |
| InChIKey | ZUJARIPSJINNCZ-KZIPNNGPSA-N |
| XLogP | 7.78 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|