C27H24ClN3O3 — CID 143337392
(Z)-4-[1-(4-chlorophenyl)-2,3,4,4a-tetrahydrocyclohepta[b]pyridin-7-yl]-2-imino-3-(phenylcarbamoyl)but-3-enoic acid (PubChem CID 143337392) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is (Z)-4-[1-(4-chlorophenyl)-2,3,4,4a-tetrahydrocyclohepta[b]pyridin-7-yl]-2-imino-3-(phenylcarbamoyl)but-3-enoic acid.
| Compound Name | (Z)-4-[1-(4-chlorophenyl)-2,3,4,4a-tetrahydrocyclohepta[b]pyridin-7-yl]-2-imino-3-(phenylcarbamoyl)but-3-enoic acid |
|---|---|
| PubChem CID | 143337392 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (Z)-4-[1-(4-chlorophenyl)-2,3,4,4a-tetrahydrocyclohepta[b]pyridin-7-yl]-2-imino-3-(phenylcarbamoyl)but-3-enoic acid |
| SMILES | [H]/N=C(C(=O)O)/C(=C/C1=CC=C2C(C=C1)CCCN2c1ccc(Cl)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H24ClN3O3/c28-20-11-13-22(14-12-20)31-16-4-5-19-10-8-18(9-15-24(19)31)17-23(25(29)27(33)34)26(32)30-21-6-2-1-3-7-21/h1-3,6-15,17,19,29H,4-5,16H2,(H,30,32)(H,33,34)/b23-17-,29-25- |
| InChIKey | LIEHXBMKYGCUHX-CABYLECTSA-N |
| XLogP | 5.61 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|