C14H32O — CID 143337423
ethane;(Z)-3,4,4,5-tetramethylhex-2-en-2-ol (PubChem CID 143337423) has the molecular formula C14H32O and a molecular weight of 216.41 g/mol. Its IUPAC name is ethane;(Z)-3,4,4,5-tetramethylhex-2-en-2-ol.
| Compound Name | ethane;(Z)-3,4,4,5-tetramethylhex-2-en-2-ol |
|---|---|
| PubChem CID | 143337423 |
| Molecular Formula | C14H32O |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.25 |
| IUPAC Name | ethane;(Z)-3,4,4,5-tetramethylhex-2-en-2-ol |
| SMILES | C/C(O)=C(\C)C(C)(C)C(C)C.CC.CC |
| InChI | InChI=1S/C10H20O.2C2H6/c1-7(2)10(5,6)8(3)9(4)11;2*1-2/h7,11H,1-6H3;2*1-2H3/b9-8-;; |
| InChIKey | XZWNBKFJSSPIEX-ULDSSAIZSA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|