C11H17NO2 — CID 143337545
methane;(2R,6R)-1-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 143337545) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methane;(2R,6R)-1-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | methane;(2R,6R)-1-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 143337545 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methane;(2R,6R)-1-methyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C.CC12CCC(C1)[C@H]1C(=O)NC(=O)[C@H]12 |
| InChI | InChI=1S/C10H13NO2.CH4/c1-10-3-2-5(4-10)6-7(10)9(13)11-8(6)12;/h5-7H,2-4H2,1H3,(H,11,12,13);1H4/t5?,6-,7+,10?;/m1./s1 |
| InChIKey | XPXMHMWCYYEKMD-ILFGRMNVSA-N |
| XLogP | 1.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|