C21H28N2O3S — CID 143337840
(2S)-8-methoxy-N,N-dimethyl-5-(2,3,6,7-tetrahydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 143337840) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is (2S)-8-methoxy-N,N-dimethyl-5-(2,3,6,7-tetrahydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-8-methoxy-N,N-dimethyl-5-(2,3,6,7-tetrahydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 143337840 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (2S)-8-methoxy-N,N-dimethyl-5-(2,3,6,7-tetrahydroindol-1-ylsulfonyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC3=C2CCC=C3)c2c1C[C@@H](N(C)C)CC2 |
| InChI | InChI=1S/C21H28N2O3S/c1-22(2)16-8-9-17-18(14-16)20(26-3)10-11-21(17)27(24,25)23-13-12-15-6-4-5-7-19(15)23/h4,6,10-11,16H,5,7-9,12-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | CHIJPNSXKDNMPF-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |