C17H25Cl2N3 — CID 143338928
(E)-N'-(1-aminoethenyl)-3-chloro-N-(3-chloro-4-methylphenyl)but-2-enimidamide;2-methylpropane (PubChem CID 143338928) has the molecular formula C17H25Cl2N3 and a molecular weight of 342.31 g/mol. Its IUPAC name is (E)-N'-(1-aminoethenyl)-3-chloro-N-(3-chloro-4-methylphenyl)but-2-enimidamide;2-methylpropane.
| Compound Name | (E)-N'-(1-aminoethenyl)-3-chloro-N-(3-chloro-4-methylphenyl)but-2-enimidamide;2-methylpropane |
|---|---|
| PubChem CID | 143338928 |
| Molecular Formula | C17H25Cl2N3 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (E)-N'-(1-aminoethenyl)-3-chloro-N-(3-chloro-4-methylphenyl)but-2-enimidamide;2-methylpropane |
| SMILES | C=C(N)/N=C(\C=C(/C)Cl)Nc1ccc(C)c(Cl)c1.CC(C)C |
| InChI | InChI=1S/C13H15Cl2N3.C4H10/c1-8-4-5-11(7-12(8)15)18-13(6-9(2)14)17-10(3)16;1-4(2)3/h4-7H,3,16H2,1-2H3,(H,17,18);4H,1-3H3/b9-6+; |
| InChIKey | NKPQTPJGFRGZFM-MLBSPLJJSA-N |
| XLogP | 5.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|