About 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide
4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide (PubChem CID 143339068) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide.
Molecular Properties
| Compound Name | 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide |
| PubChem CID | 143339068 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide |
| SMILES | [H]/N=C(/CC(C)C1=CCCC=CC1)C(N)=O |
| InChI | InChI=1S/C12H18N2O/c1-9(8-11(13)12(14)15)10-6-4-2-3-5-7-10/h2,4,7,9,13H,3,5-6,8H2,1H3,(H2,14,15)/b13-11- |
| InChIKey | QHKHDTOIYPQSQW-QBFSEMIESA-N |
| XLogP | 2.18 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide?
The IUPAC name of 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide (CID 143339068) is 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide.
What is the SMILES notation for 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide?
The canonical SMILES for 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide is [H]/N=C(/CC(C)C1=CCCC=CC1)C(N)=O.
What is the InChIKey of 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide?
The InChIKey is QHKHDTOIYPQSQW-QBFSEMIESA-N. The full InChI is InChI=1S/C12H18N2O/c1-9(8-11(13)12(14)15)10-6-4-2-3-5-7-10/h2,4,7,9,13H,3,5-6,8H2,1H3,(H2,14,15)/b13-11-.
What are the key properties of 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide?
4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide has a molecular weight of 206.29 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohepta-1,5-dien-1-yl-2-iminopentanamide is sourced from PubChem (CID 143339068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).