About (3-methyl-2,3-dihydrofuran-5-yl)methanamine
(3-methyl-2,3-dihydrofuran-5-yl)methanamine (PubChem CID 143339092) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is (3-methyl-2,3-dihydrofuran-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-methyl-2,3-dihydrofuran-5-yl)methanamine |
| PubChem CID | 143339092 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (3-methyl-2,3-dihydrofuran-5-yl)methanamine |
| SMILES | CC1C=C(CN)OC1 |
| InChI | InChI=1S/C6H11NO/c1-5-2-6(3-7)8-4-5/h2,5H,3-4,7H2,1H3 |
| InChIKey | NMNJIXIOQZNXQX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methyl-2,3-dihydrofuran-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2,3-dihydrofuran-5-yl)methanamine?
The IUPAC name of (3-methyl-2,3-dihydrofuran-5-yl)methanamine (CID 143339092) is (3-methyl-2,3-dihydrofuran-5-yl)methanamine.
What is the SMILES notation for (3-methyl-2,3-dihydrofuran-5-yl)methanamine?
The canonical SMILES for (3-methyl-2,3-dihydrofuran-5-yl)methanamine is CC1C=C(CN)OC1.
What is the InChIKey of (3-methyl-2,3-dihydrofuran-5-yl)methanamine?
The InChIKey is NMNJIXIOQZNXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-5-2-6(3-7)8-4-5/h2,5H,3-4,7H2,1H3.
What are the key properties of (3-methyl-2,3-dihydrofuran-5-yl)methanamine?
(3-methyl-2,3-dihydrofuran-5-yl)methanamine has a molecular weight of 113.16 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2,3-dihydrofuran-5-yl)methanamine is sourced from PubChem (CID 143339092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).