About S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine
S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine (PubChem CID 143339269) has the molecular formula C7H16N2S
and a molecular weight of 160.29 g/mol. Its IUPAC name is S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine.
Molecular Properties
| Compound Name | S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine |
| PubChem CID | 143339269 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine |
| SMILES | CN1CCC(C)(SN)CC1 |
| InChI | InChI=1S/C7H16N2S/c1-7(10-8)3-5-9(2)6-4-7/h3-6,8H2,1-2H3 |
| InChIKey | MIELKMLJLKGXRS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine?
The IUPAC name of S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine (CID 143339269) is S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine.
What is the SMILES notation for S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine?
The canonical SMILES for S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine is CN1CCC(C)(SN)CC1.
What is the InChIKey of S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine?
The InChIKey is MIELKMLJLKGXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2S/c1-7(10-8)3-5-9(2)6-4-7/h3-6,8H2,1-2H3.
What are the key properties of S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine?
S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine has a molecular weight of 160.29 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine is sourced from PubChem (CID 143339269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).