C21H25Cl2O4P — CID 143339932
(2S)-4-(3,5-dichlorophenyl)-2-[(5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 143339932) has the molecular formula C21H25Cl2O4P and a molecular weight of 443.31 g/mol. Its IUPAC name is (2S)-4-(3,5-dichlorophenyl)-2-[(5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | (2S)-4-(3,5-dichlorophenyl)-2-[(5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 143339932 |
| Molecular Formula | C21H25Cl2O4P |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (2S)-4-(3,5-dichlorophenyl)-2-[(5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethyl]-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CCC1=C(C)CC=C(OC[P@]2(=O)OCCC(c3cc(Cl)cc(Cl)c3)O2)C=C1C |
| InChI | InChI=1S/C21H25Cl2O4P/c1-4-20-14(2)5-6-19(9-15(20)3)25-13-28(24)26-8-7-21(27-28)16-10-17(22)12-18(23)11-16/h6,9-12,21H,4-5,7-8,13H2,1-3H3/t21?,28-/m0/s1 |
| InChIKey | XAEYWSJCSZBSCD-QVWGJOIVSA-N |
| XLogP | 7.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|