C12H19O3P — CID 143340055
(5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethylphosphonous acid (PubChem CID 143340055) has the molecular formula C12H19O3P and a molecular weight of 242.25 g/mol. Its IUPAC name is (5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethylphosphonous acid.
| Compound Name | (5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethylphosphonous acid |
|---|---|
| PubChem CID | 143340055 |
| Molecular Formula | C12H19O3P |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (5-ethyl-4,6-dimethylcyclohepta-1,4,6-trien-1-yl)oxymethylphosphonous acid |
| SMILES | CCC1=C(C)CC=C(OCP(O)O)C=C1C |
| InChI | InChI=1S/C12H19O3P/c1-4-12-9(2)5-6-11(7-10(12)3)15-8-16(13)14/h6-7,13-14H,4-5,8H2,1-3H3 |
| InChIKey | FHOKGPCOBRMBRH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|