C22H45NO — CID 143340483
ethane;(2E,4E)-N-ethyl-N-(2-methoxyethyl)-3-propan-2-ylhepta-2,4-dien-4-amine;(Z)-pent-2-ene (PubChem CID 143340483) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is ethane;(2E,4E)-N-ethyl-N-(2-methoxyethyl)-3-propan-2-ylhepta-2,4-dien-4-amine;(Z)-pent-2-ene.
| Compound Name | ethane;(2E,4E)-N-ethyl-N-(2-methoxyethyl)-3-propan-2-ylhepta-2,4-dien-4-amine;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 143340483 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | ethane;(2E,4E)-N-ethyl-N-(2-methoxyethyl)-3-propan-2-ylhepta-2,4-dien-4-amine;(Z)-pent-2-ene |
| SMILES | C/C=C(C(=C\CC)/N(CC)CCOC)\C(C)C.C/C=C\CC.CC |
| InChI | InChI=1S/C15H29NO.C5H10.C2H6/c1-7-10-15(14(8-2)13(4)5)16(9-3)11-12-17-6;1-3-5-4-2;1-2/h8,10,13H,7,9,11-12H2,1-6H3;3,5H,4H2,1-2H3;1-2H3/b14-8+,15-10+;5-3-; |
| InChIKey | HHMMCZFBMAJRGB-MRBSQFABSA-N |
| XLogP | 6.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|