C19H25N7O — CID 143341670
2-[[8-(3-methylanilino)-6-piperidin-1-yl-7H-purin-2-yl]amino]ethanol (PubChem CID 143341670) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-[[8-(3-methylanilino)-6-piperidin-1-yl-7H-purin-2-yl]amino]ethanol.
| Compound Name | 2-[[8-(3-methylanilino)-6-piperidin-1-yl-7H-purin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 143341670 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-[[8-(3-methylanilino)-6-piperidin-1-yl-7H-purin-2-yl]amino]ethanol |
| SMILES | Cc1cccc(Nc2nc3nc(NCCO)nc(N4CCCCC4)c3[nH]2)c1 |
| InChI | InChI=1S/C19H25N7O/c1-13-6-5-7-14(12-13)21-19-22-15-16(24-19)23-18(20-8-11-27)25-17(15)26-9-3-2-4-10-26/h5-7,12,27H,2-4,8-11H2,1H3,(H3,20,21,22,23,24,25) |
| InChIKey | YNMVXKOGEQIDTK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |