C16H20FN3 — CID 143342012
2-N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-3,4-dimethylidenecyclobutene-1,2-diamine;ethene (PubChem CID 143342012) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-3,4-dimethylidenecyclobutene-1,2-diamine;ethene.
| Compound Name | 2-N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-3,4-dimethylidenecyclobutene-1,2-diamine;ethene |
|---|---|
| PubChem CID | 143342012 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-3,4-dimethylidenecyclobutene-1,2-diamine;ethene |
| SMILES | C=C.C=C1C(=C)C(NCc2cc(CN)ccc2F)=C1N |
| InChI | InChI=1S/C14H16FN3.C2H4/c1-8-9(2)14(13(8)17)18-7-11-5-10(6-16)3-4-12(11)15;1-2/h3-5,18H,1-2,6-7,16-17H2;1-2H2 |
| InChIKey | REILVQZQMBDGDC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|