About 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole
4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole (PubChem CID 143342063) has the molecular formula C10H12F2O2
and a molecular weight of 202.20 g/mol. Its IUPAC name is 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole.
Molecular Properties
| Compound Name | 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole |
| PubChem CID | 143342063 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole |
| SMILES | C=CC1=C(/C=C(\C)CC)OC(F)(F)O1 |
| InChI | InChI=1S/C10H12F2O2/c1-4-7(3)6-9-8(5-2)13-10(11,12)14-9/h5-6H,2,4H2,1,3H3/b7-6+ |
| InChIKey | BSGNUAYWUHEKHO-VOTSOKGWSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole?
The IUPAC name of 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole (CID 143342063) is 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole.
What is the SMILES notation for 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole?
The canonical SMILES for 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole is C=CC1=C(/C=C(\C)CC)OC(F)(F)O1.
What is the InChIKey of 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole?
The InChIKey is BSGNUAYWUHEKHO-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H12F2O2/c1-4-7(3)6-9-8(5-2)13-10(11,12)14-9/h5-6H,2,4H2,1,3H3/b7-6+.
What are the key properties of 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole?
4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole has a molecular weight of 202.20 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-2,2-difluoro-5-[(E)-2-methylbut-1-enyl]-1,3-dioxole is sourced from PubChem (CID 143342063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).