C27H31F2N7O3 — CID 143342111
5-N-[[2-(difluoromethyl)-5H-1,3-diazepin-4-yl]methyl]-7-N-[(3E,8E)-9-methyl-11-oxoundeca-3,8-dien-5-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 143342111) has the molecular formula C27H31F2N7O3 and a molecular weight of 539.59 g/mol. Its IUPAC name is 5-N-[[2-(difluoromethyl)-5H-1,3-diazepin-4-yl]methyl]-7-N-[(3E,8E)-9-methyl-11-oxoundeca-3,8-dien-5-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 5-N-[[2-(difluoromethyl)-5H-1,3-diazepin-4-yl]methyl]-7-N-[(3E,8E)-9-methyl-11-oxoundeca-3,8-dien-5-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 143342111 |
| Molecular Formula | C27H31F2N7O3 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 5-N-[[2-(difluoromethyl)-5H-1,3-diazepin-4-yl]methyl]-7-N-[(3E,8E)-9-methyl-11-oxoundeca-3,8-dien-5-yl]pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | CC/C=C/C(CC/C=C(\C)CC=O)NC(=O)c1cc(C(=O)NCC2=NC(C(F)F)=NC=CC2)nc2ccnn12 |
| InChI | InChI=1S/C27H31F2N7O3/c1-3-4-8-19(9-5-7-18(2)12-15-37)34-27(39)22-16-21(35-23-11-14-32-36(22)23)26(38)31-17-20-10-6-13-30-25(33-20)24(28)29/h4,6-8,11,13-16,19,24H,3,5,9-10,12,17H2,1-2H3,(H,31,38)(H,34,39)/b8-4+,18-7+ |
| InChIKey | SBXWOPSSBMAYPZ-ICVWRESCSA-N |
| XLogP | 3.86 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|