About (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine
(Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine (PubChem CID 143342121) has the molecular formula C9H15F3N2
and a molecular weight of 208.23 g/mol. Its IUPAC name is (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine |
| PubChem CID | 143342121 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine |
| SMILES | CC/C(=N\C=C/C(C)CN)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2/c1-3-8(9(10,11)12)14-5-4-7(2)6-13/h4-5,7H,3,6,13H2,1-2H3/b5-4-,14-8+ |
| InChIKey | YRIHSXNVWONJSZ-HNQGTOQISA-N |
| XLogP | 2.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine?
The IUPAC name of (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine (CID 143342121) is (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine.
What is the SMILES notation for (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine?
The canonical SMILES for (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine is CC/C(=N\C=C/C(C)CN)C(F)(F)F.
What is the InChIKey of (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine?
The InChIKey is YRIHSXNVWONJSZ-HNQGTOQISA-N. The full InChI is InChI=1S/C9H15F3N2/c1-3-8(9(10,11)12)14-5-4-7(2)6-13/h4-5,7H,3,6,13H2,1-2H3/b5-4-,14-8+.
What are the key properties of (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine?
(Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine has a molecular weight of 208.23 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-methyl-4-(1,1,1-trifluorobutan-2-ylideneamino)but-3-en-1-amine is sourced from PubChem (CID 143342121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).