C20H33N3 — CID 143342222
8-ethenylimino-6-N,4,9-trimethyl-2-N-(2-methylidenebutyl)deca-1,5,9-triene-2,6-diamine (PubChem CID 143342222) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is 8-ethenylimino-6-N,4,9-trimethyl-2-N-(2-methylidenebutyl)deca-1,5,9-triene-2,6-diamine.
| Compound Name | 8-ethenylimino-6-N,4,9-trimethyl-2-N-(2-methylidenebutyl)deca-1,5,9-triene-2,6-diamine |
|---|---|
| PubChem CID | 143342222 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | 8-ethenylimino-6-N,4,9-trimethyl-2-N-(2-methylidenebutyl)deca-1,5,9-triene-2,6-diamine |
| SMILES | C=C/N=C(/CC(=CC(C)CC(=C)NCC(=C)CC)NC)C(=C)C |
| InChI | InChI=1S/C20H33N3/c1-9-16(5)14-23-18(7)11-17(6)12-19(21-8)13-20(15(3)4)22-10-2/h10,12,17,21,23H,2-3,5,7,9,11,13-14H2,1,4,6,8H3/b19-12?,22-20- |
| InChIKey | YHUWHODTUVCTAS-HRBPFDDNSA-N |
| XLogP | 4.74 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|