About ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine
ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine (PubChem CID 143342448) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine.
Molecular Properties
| Compound Name | ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine |
| PubChem CID | 143342448 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine |
| SMILES | C=C/C(=C\C(C=O)=C/C)CC.CC.CN |
| InChI | InChI=1S/C10H14O.C2H6.CH5N/c1-4-9(5-2)7-10(6-3)8-11;2*1-2/h4,6-8H,1,5H2,2-3H3;1-2H3;2H2,1H3/b9-7+,10-6+;; |
| InChIKey | RPRDNERQYUBFTK-YGEHUGHFSA-N |
| XLogP | 3.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine?
The IUPAC name of ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine (CID 143342448) is ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine.
What is the SMILES notation for ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine?
The canonical SMILES for ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine is C=C/C(=C\C(C=O)=C/C)CC.CC.CN.
What is the InChIKey of ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine?
The InChIKey is RPRDNERQYUBFTK-YGEHUGHFSA-N. The full InChI is InChI=1S/C10H14O.C2H6.CH5N/c1-4-9(5-2)7-10(6-3)8-11;2*1-2/h4,6-8H,1,5H2,2-3H3;1-2H3;2H2,1H3/b9-7+,10-6+;;.
What are the key properties of ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine?
ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine has a molecular weight of 211.35 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,3Z)-4-ethyl-2-ethylidenehexa-3,5-dienal;methanamine is sourced from PubChem (CID 143342448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).