About (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane
(3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane (PubChem CID 143342855) has the molecular formula C16H31F2N
and a molecular weight of 275.43 g/mol. Its IUPAC name is (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane.
Molecular Properties
| Compound Name | (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane |
| PubChem CID | 143342855 |
| Molecular Formula | C16H31F2N |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane |
| SMILES | C=C/C(=C(\C=C/C)C(C)NC)C(C)(F)F.CC.CC |
| InChI | InChI=1S/C12H19F2N.2C2H6/c1-6-8-10(9(3)15-5)11(7-2)12(4,13)14;2*1-2/h6-9,15H,2H2,1,3-5H3;2*1-2H3/b8-6-,11-10-;; |
| InChIKey | XAESIERFKFLPIM-DWRFMRTHSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane?
The IUPAC name of (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane (CID 143342855) is (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane.
What is the SMILES notation for (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane?
The canonical SMILES for (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane is C=C/C(=C(\C=C/C)C(C)NC)C(C)(F)F.CC.CC.
What is the InChIKey of (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane?
The InChIKey is XAESIERFKFLPIM-DWRFMRTHSA-N. The full InChI is InChI=1S/C12H19F2N.2C2H6/c1-6-8-10(9(3)15-5)11(7-2)12(4,13)14;2*1-2/h6-9,15H,2H2,1,3-5H3;2*1-2H3/b8-6-,11-10-;;.
What are the key properties of (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane?
(3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane has a molecular weight of 275.43 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-(1,1-difluoroethyl)-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-amine;ethane is sourced from PubChem (CID 143342855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).