C33H42N4O — CID 143343087
(1E,8Z)-6-[[(3E)-3-methyl-6-[(2-methylidene-1,3,4,5-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-5-prop-1-en-2-yliminohepta-1,3,6-trien-2-yl]amino]cyclonona-1,8-diene-1-carbaldehyde (PubChem CID 143343087) has the molecular formula C33H42N4O and a molecular weight of 510.73 g/mol. Its IUPAC name is (1E,8Z)-6-[[(3E)-3-methyl-6-[(2-methylidene-1,3,4,5-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-5-prop-1-en-2-yliminohepta-1,3,6-trien-2-yl]amino]cyclonona-1,8-diene-1-carbaldehyde.
| Compound Name | (1E,8Z)-6-[[(3E)-3-methyl-6-[(2-methylidene-1,3,4,5-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-5-prop-1-en-2-yliminohepta-1,3,6-trien-2-yl]amino]cyclonona-1,8-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 143343087 |
| Molecular Formula | C33H42N4O |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (1E,8Z)-6-[[(3E)-3-methyl-6-[(2-methylidene-1,3,4,5-tetrahydrocyclohepta[b]pyridin-8-yl)methylamino]-5-prop-1-en-2-yliminohepta-1,3,6-trien-2-yl]amino]cyclonona-1,8-diene-1-carbaldehyde |
| SMILES | C=C(C)/N=C(\C=C(/C)C(=C)NC1C/C=C\C(C=O)=C/CCC1)C(=C)NCC1=CC2=C(CC=C1)CCC(=C)N2 |
| InChI | InChI=1S/C33H42N4O/c1-23(2)35-32(19-24(3)26(5)37-31-15-8-7-11-28(22-38)12-10-16-31)27(6)34-21-29-13-9-14-30-18-17-25(4)36-33(30)20-29/h9-13,19-20,22,31,34,36-37H,1,4-8,14-18,21H2,2-3H3/b12-10-,24-19+,28-11+,35-32+ |
| InChIKey | VSIJESVNBLVKFY-OTDKRWHKSA-N |
| XLogP | 6.78 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|