About carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone
carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone (PubChem CID 143343093) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone.
Molecular Properties
| Compound Name | carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone |
| PubChem CID | 143343093 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone |
| SMILES | CC.CC(=O)c1ccc2c(c1)CCC2O.O=C=O |
| InChI | InChI=1S/C11H12O2.C2H6.CO2/c1-7(12)8-2-4-10-9(6-8)3-5-11(10)13;1-2;2-1-3/h2,4,6,11,13H,3,5H2,1H3;1-2H3; |
| InChIKey | KDFWZNYPYLWEEB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone?
The IUPAC name of carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone (CID 143343093) is carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone.
What is the SMILES notation for carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone?
The canonical SMILES for carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone is CC.CC(=O)c1ccc2c(c1)CCC2O.O=C=O.
What is the InChIKey of carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone?
The InChIKey is KDFWZNYPYLWEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.C2H6.CO2/c1-7(12)8-2-4-10-9(6-8)3-5-11(10)13;1-2;2-1-3/h2,4,6,11,13H,3,5H2,1H3;1-2H3;.
What are the key properties of carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone?
carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone has a molecular weight of 250.29 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;ethane;1-(1-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanone is sourced from PubChem (CID 143343093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).