C23H32FN3O — CID 143343368
(2Z)-2-[[(Z)-but-2-en-2-yl]-methylamino]-5-[(4-fluoro-3-methylcyclohepta-1,3,6-trien-1-yl)methylamino]-4-methylidenehexa-2,5-dienamide;ethene (PubChem CID 143343368) has the molecular formula C23H32FN3O and a molecular weight of 385.53 g/mol. Its IUPAC name is (2Z)-2-[[(Z)-but-2-en-2-yl]-methylamino]-5-[(4-fluoro-3-methylcyclohepta-1,3,6-trien-1-yl)methylamino]-4-methylidenehexa-2,5-dienamide;ethene.
| Compound Name | (2Z)-2-[[(Z)-but-2-en-2-yl]-methylamino]-5-[(4-fluoro-3-methylcyclohepta-1,3,6-trien-1-yl)methylamino]-4-methylidenehexa-2,5-dienamide;ethene |
|---|---|
| PubChem CID | 143343368 |
| Molecular Formula | C23H32FN3O |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (2Z)-2-[[(Z)-but-2-en-2-yl]-methylamino]-5-[(4-fluoro-3-methylcyclohepta-1,3,6-trien-1-yl)methylamino]-4-methylidenehexa-2,5-dienamide;ethene |
| SMILES | C=C.C=C(/C=C(/C(N)=O)N(C)/C(C)=C\C)C(=C)NCC1=CC(C)=C(F)CC=C1 |
| InChI | InChI=1S/C21H28FN3O.C2H4/c1-7-16(4)25(6)20(21(23)26)12-14(2)17(5)24-13-18-9-8-10-19(22)15(3)11-18;1-2/h7-9,11-12,24H,2,5,10,13H2,1,3-4,6H3,(H2,23,26);1-2H2/b16-7-,20-12-; |
| InChIKey | BRIWFLITILZMRZ-GNRMVRODSA-N |
| XLogP | 4.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|