C16H20N2O2 — CID 143343446
3-amino-4-[[2-[(1Z)-2-ethylbuta-1,3-dienyl]-3-methylcyclopent-2-en-1-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 143343446) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-amino-4-[[2-[(1Z)-2-ethylbuta-1,3-dienyl]-3-methylcyclopent-2-en-1-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[[2-[(1Z)-2-ethylbuta-1,3-dienyl]-3-methylcyclopent-2-en-1-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 143343446 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-amino-4-[[2-[(1Z)-2-ethylbuta-1,3-dienyl]-3-methylcyclopent-2-en-1-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C=C/C(=C\C1=C(C)CCC1Nc1c(N)c(=O)c1=O)CC |
| InChI | InChI=1S/C16H20N2O2/c1-4-10(5-2)8-11-9(3)6-7-12(11)18-14-13(17)15(19)16(14)20/h4,8,12,18H,1,5-7,17H2,2-3H3/b10-8+ |
| InChIKey | FRTIVIHJWIHCTI-CSKARUKUSA-N |
| XLogP | 2.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|