C12H17NO — CID 143343499
(1S)-4-(2-methoxyprop-2-enyl)-1,2,3,4-tetrahydropentalen-1-amine (PubChem CID 143343499) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (1S)-4-(2-methoxyprop-2-enyl)-1,2,3,4-tetrahydropentalen-1-amine.
| Compound Name | (1S)-4-(2-methoxyprop-2-enyl)-1,2,3,4-tetrahydropentalen-1-amine |
|---|---|
| PubChem CID | 143343499 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1S)-4-(2-methoxyprop-2-enyl)-1,2,3,4-tetrahydropentalen-1-amine |
| SMILES | C=C(CC1C=CC2=C1CC[C@@H]2N)OC |
| InChI | InChI=1S/C12H17NO/c1-8(14-2)7-9-3-4-11-10(9)5-6-12(11)13/h3-4,9,12H,1,5-7,13H2,2H3/t9?,12-/m0/s1 |
| InChIKey | AADPSMZRGPFQPU-ACGXKRRESA-N |
| XLogP | 2.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|