C30H25FN8O5 — CID 143343766
7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-5-N-[(1S)-5-carbamoyl-2,3-dihydro-1H-inden-1-yl]imidazo[1,2-a]pyrimidine-5,7-dicarboxamide (PubChem CID 143343766) has the molecular formula C30H25FN8O5 and a molecular weight of 596.58 g/mol. Its IUPAC name is 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-5-N-[(1S)-5-carbamoyl-2,3-dihydro-1H-inden-1-yl]imidazo[1,2-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-5-N-[(1S)-5-carbamoyl-2,3-dihydro-1H-inden-1-yl]imidazo[1,2-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 143343766 |
| Molecular Formula | C30H25FN8O5 |
| Molecular Weight | 596.58 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 7-N-[[3-[[(2-amino-3,4-dioxocyclobuten-1-yl)amino]methyl]-4-fluorophenyl]methyl]-5-N-[(1S)-5-carbamoyl-2,3-dihydro-1H-inden-1-yl]imidazo[1,2-a]pyrimidine-5,7-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(c1)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(F)c(CNc3c(N)c(=O)c3=O)c2)nc2nccn12 |
| InChI | InChI=1S/C30H25FN8O5/c31-19-5-1-14(9-17(19)13-35-24-23(32)25(40)26(24)41)12-36-28(43)21-11-22(39-8-7-34-30(39)38-21)29(44)37-20-6-3-15-10-16(27(33)42)2-4-18(15)20/h1-2,4-5,7-11,20,35H,3,6,12-13,32H2,(H2,33,42)(H,36,43)(H,37,44)/t20-/m0/s1 |
| InChIKey | ZTJWAMAUAWJZSV-FQEVSTJZSA-N |
| XLogP | 1.10 |
| TPSA | 203.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|