C32H52N4 — CID 143343794
ethane;N-[2-[[(2E,5E)-2-ethenyl-4,7-dimethyl-6-propan-2-ylocta-2,5,7-trienyl]amino]-7,8-dimethylnona-1,5,8-trien-3-ylidene]-N'-(methyliminomethyl)ethanimidamide (PubChem CID 143343794) has the molecular formula C32H52N4 and a molecular weight of 492.80 g/mol. Its IUPAC name is ethane;N-[2-[[(2E,5E)-2-ethenyl-4,7-dimethyl-6-propan-2-ylocta-2,5,7-trienyl]amino]-7,8-dimethylnona-1,5,8-trien-3-ylidene]-N'-(methyliminomethyl)ethanimidamide.
| Compound Name | ethane;N-[2-[[(2E,5E)-2-ethenyl-4,7-dimethyl-6-propan-2-ylocta-2,5,7-trienyl]amino]-7,8-dimethylnona-1,5,8-trien-3-ylidene]-N'-(methyliminomethyl)ethanimidamide |
|---|---|
| PubChem CID | 143343794 |
| Molecular Formula | C32H52N4 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.42 |
| IUPAC Name | ethane;N-[2-[[(2E,5E)-2-ethenyl-4,7-dimethyl-6-propan-2-ylocta-2,5,7-trienyl]amino]-7,8-dimethylnona-1,5,8-trien-3-ylidene]-N'-(methyliminomethyl)ethanimidamide |
| SMILES | C=C/C(=C\C(C)/C=C(/C(=C)C)C(C)C)CNC(=C)/C(CC=CC(C)C(=C)C)=N/C(C)=N/C=N/C.CC |
| InChI | InChI=1S/C30H46N4.C2H6/c1-13-28(17-24(8)18-29(22(4)5)23(6)7)19-32-26(10)30(34-27(11)33-20-31-12)16-14-15-25(9)21(2)3;1-2/h13-15,17-18,20,23-25,32H,1-2,4,10,16,19H2,3,5-9,11-12H3;1-2H3/b15-14?,28-17+,29-18-,31-20+,33-27+,34-30+; |
| InChIKey | HZNUWVRBXOQEAE-FPLHCWITSA-N |
| XLogP | 8.70 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|