About ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane
ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane (PubChem CID 143343941) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane.
Molecular Properties
| Compound Name | ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane |
| PubChem CID | 143343941 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane |
| SMILES | C/C=C(/C)C=CC/N=C(\C)C#N.CC.CCC |
| InChI | InChI=1S/C10H14N2.C3H8.C2H6/c1-4-9(2)6-5-7-12-10(3)8-11;1-3-2;1-2/h4-6H,7H2,1-3H3;3H2,1-2H3;1-2H3/b6-5?,9-4-,12-10+;; |
| InChIKey | OKKSBLRAINWXPV-ZXLRPIRQSA-N |
| XLogP | 4.94 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane?
The IUPAC name of ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane (CID 143343941) is ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane.
What is the SMILES notation for ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane?
The canonical SMILES for ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane is C/C=C(/C)C=CC/N=C(\C)C#N.CC.CCC.
What is the InChIKey of ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane?
The InChIKey is OKKSBLRAINWXPV-ZXLRPIRQSA-N. The full InChI is InChI=1S/C10H14N2.C3H8.C2H6/c1-4-9(2)6-5-7-12-10(3)8-11;1-3-2;1-2/h4-6H,7H2,1-3H3;3H2,1-2H3;1-2H3/b6-5?,9-4-,12-10+;;.
What are the key properties of ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane?
ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane has a molecular weight of 236.40 g/mol, XLogP of 4.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(4Z)-4-methylhexa-2,4-dienyl]ethanimidoyl cyanide;propane is sourced from PubChem (CID 143343941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).