C11H14O3S — CID 143343978
1-(3-hydroxy-1-methylidene-1-oxo-2,3,3a,7a-tetrahydro-1-benzothiophen-6-yl)ethanone (PubChem CID 143343978) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(3-hydroxy-1-methylidene-1-oxo-2,3,3a,7a-tetrahydro-1-benzothiophen-6-yl)ethanone.
| Compound Name | 1-(3-hydroxy-1-methylidene-1-oxo-2,3,3a,7a-tetrahydro-1-benzothiophen-6-yl)ethanone |
|---|---|
| PubChem CID | 143343978 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(3-hydroxy-1-methylidene-1-oxo-2,3,3a,7a-tetrahydro-1-benzothiophen-6-yl)ethanone |
| SMILES | C=S1(=O)CC(O)C2C=CC(C(C)=O)=CC21 |
| InChI | InChI=1S/C11H14O3S/c1-7(12)8-3-4-9-10(13)6-15(2,14)11(9)5-8/h3-5,9-11,13H,2,6H2,1H3 |
| InChIKey | CSAIAGZOXOORMJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|