C15H22N2O — CID 143343979
N'-ethenyl-N-methyl-N-[(4Z)-2-methyl-6-methylidene-7-oxoocta-1,4-dien-4-yl]ethanimidamide (PubChem CID 143343979) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N'-ethenyl-N-methyl-N-[(4Z)-2-methyl-6-methylidene-7-oxoocta-1,4-dien-4-yl]ethanimidamide.
| Compound Name | N'-ethenyl-N-methyl-N-[(4Z)-2-methyl-6-methylidene-7-oxoocta-1,4-dien-4-yl]ethanimidamide |
|---|---|
| PubChem CID | 143343979 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N'-ethenyl-N-methyl-N-[(4Z)-2-methyl-6-methylidene-7-oxoocta-1,4-dien-4-yl]ethanimidamide |
| SMILES | C=C/N=C(\C)N(C)/C(=C\C(=C)C(C)=O)CC(=C)C |
| InChI | InChI=1S/C15H22N2O/c1-8-16-14(6)17(7)15(9-11(2)3)10-12(4)13(5)18/h8,10H,1-2,4,9H2,3,5-7H3/b15-10-,16-14+ |
| InChIKey | JVEQQMMYCCNKII-OPQFGGCESA-N |
| XLogP | 3.48 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|