About (E)-2-aminobut-2-enedial
(E)-2-aminobut-2-enedial (PubChem CID 143344030) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is (E)-2-aminobut-2-enedial.
Molecular Properties
| Compound Name | (E)-2-aminobut-2-enedial |
| PubChem CID | 143344030 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | (E)-2-aminobut-2-enedial |
| SMILES | N/C(C=O)=C/C=O |
| InChI | InChI=1S/C4H5NO2/c5-4(3-7)1-2-6/h1-3H,5H2/b4-1+ |
| InChIKey | DGRUHEFWGHRUAS-DAFODLJHSA-N |
| XLogP | -0.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-aminobut-2-enedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-aminobut-2-enedial?
The IUPAC name of (E)-2-aminobut-2-enedial (CID 143344030) is (E)-2-aminobut-2-enedial.
What is the SMILES notation for (E)-2-aminobut-2-enedial?
The canonical SMILES for (E)-2-aminobut-2-enedial is N/C(C=O)=C/C=O.
What is the InChIKey of (E)-2-aminobut-2-enedial?
The InChIKey is DGRUHEFWGHRUAS-DAFODLJHSA-N. The full InChI is InChI=1S/C4H5NO2/c5-4(3-7)1-2-6/h1-3H,5H2/b4-1+.
What are the key properties of (E)-2-aminobut-2-enedial?
(E)-2-aminobut-2-enedial has a molecular weight of 99.09 g/mol, XLogP of -0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-aminobut-2-enedial is sourced from PubChem (CID 143344030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).