About (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen
(1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen (PubChem CID 143344145) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen.
Molecular Properties
| Compound Name | (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen |
| PubChem CID | 143344145 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen |
| SMILES | C=C(OC)C1=CC=C([C@H](C)N)CC1.[H][H] |
| InChI | InChI=1S/C11H17NO.H2/c1-8(12)10-4-6-11(7-5-10)9(2)13-3;/h4,6,8H,2,5,7,12H2,1,3H3;1H/t8-;/m0./s1 |
| InChIKey | VHIQFCSOHLSKGR-QRPNPIFTSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen?
The IUPAC name of (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen (CID 143344145) is (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen.
What is the SMILES notation for (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen?
The canonical SMILES for (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen is C=C(OC)C1=CC=C([C@H](C)N)CC1.[H][H].
What is the InChIKey of (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen?
The InChIKey is VHIQFCSOHLSKGR-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H17NO.H2/c1-8(12)10-4-6-11(7-5-10)9(2)13-3;/h4,6,8H,2,5,7,12H2,1,3H3;1H/t8-;/m0./s1.
What are the key properties of (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen?
(1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen has a molecular weight of 181.28 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[4-(1-methoxyethenyl)cyclohexa-1,3-dien-1-yl]ethanamine;molecular hydrogen is sourced from PubChem (CID 143344145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).