C29H33N7O4 — CID 143344270
tert-butyl (1S)-1-[[[5-[(3-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-hydroxymethyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 143344270) has the molecular formula C29H33N7O4 and a molecular weight of 543.63 g/mol. Its IUPAC name is tert-butyl (1S)-1-[[[5-[(3-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-hydroxymethyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | tert-butyl (1S)-1-[[[5-[(3-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-hydroxymethyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 143344270 |
| Molecular Formula | C29H33N7O4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | tert-butyl (1S)-1-[[[5-[(3-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-hydroxymethyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)C)ccc2c1CC[C@@H]2NC(O)c1cc(C(=O)NCc2cccc(N)c2)nc2ncnn12 |
| InChI | InChI=1S/C29H33N7O4/c1-16-19-10-11-22(21(19)9-8-20(16)27(39)40-29(2,3)4)34-26(38)24-13-23(35-28-32-15-33-36(24)28)25(37)31-14-17-6-5-7-18(30)12-17/h5-9,12-13,15,22,26,34,38H,10-11,14,30H2,1-4H3,(H,31,37)/t22-,26?/m0/s1 |
| InChIKey | PZSYRFIQVDXFMU-CHQVSRGASA-N |
| XLogP | 3.17 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|